C25H33FNO2+ — CID 1399047
(1R,2R)-1-cyclohexyl-1-(4-fluorophenyl)-3-morpholin-4-ium-4-yl-2-phenylpropan-1-ol (PubChem CID 1399047) has the molecular formula C25H33FNO2+ and a molecular weight of 398.54 g/mol. Its IUPAC name is (1R,2R)-1-cyclohexyl-1-(4-fluorophenyl)-3-morpholin-4-ium-4-yl-2-phenylpropan-1-ol.
| Compound Name | (1R,2R)-1-cyclohexyl-1-(4-fluorophenyl)-3-morpholin-4-ium-4-yl-2-phenylpropan-1-ol |
|---|---|
| PubChem CID | 1399047 |
| Molecular Formula | C25H33FNO2+ |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (1R,2R)-1-cyclohexyl-1-(4-fluorophenyl)-3-morpholin-4-ium-4-yl-2-phenylpropan-1-ol |
| SMILES | O[C@](c1ccc(F)cc1)(C1CCCCC1)[C@@H](C[NH+]1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C25H32FNO2/c26-23-13-11-22(12-14-23)25(28,21-9-5-2-6-10-21)24(20-7-3-1-4-8-20)19-27-15-17-29-18-16-27/h1,3-4,7-8,11-14,21,24,28H,2,5-6,9-10,15-19H2/p+1/t24-,25-/m0/s1 |
| InChIKey | KIELZMVDBJNNDM-DQEYMECFSA-O |
| XLogP | 3.29 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |