C14H18FN5O — CID 139904923
6-(2-fluoropropan-2-yl)-2-N-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 139904923) has the molecular formula C14H18FN5O and a molecular weight of 291.33 g/mol. Its IUPAC name is 6-(2-fluoropropan-2-yl)-2-N-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-fluoropropan-2-yl)-2-N-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139904923 |
| Molecular Formula | C14H18FN5O |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 6-(2-fluoropropan-2-yl)-2-N-(4,5,6,7-tetrahydro-1-benzofuran-7-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(F)c1nc(N)nc(NC2CCCc3ccoc32)n1 |
| InChI | InChI=1S/C14H18FN5O/c1-14(2,15)11-18-12(16)20-13(19-11)17-9-5-3-4-8-6-7-21-10(8)9/h6-7,9H,3-5H2,1-2H3,(H3,16,17,18,19,20) |
| InChIKey | WLYYRMRWYIXJKR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |