About 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide
1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide (PubChem CID 1399053) has the molecular formula C20H20N2O6S2
and a molecular weight of 448.52 g/mol. Its IUPAC name is 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide.
Molecular Properties
| Compound Name | 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide |
| PubChem CID | 1399053 |
| Molecular Formula | C20H20N2O6S2 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide |
| SMILES | CCS(=O)(=O)c1c(C(=O)c2ccccc2)c2ccc(C(N)=O)cn2c1S(=O)(=O)CC |
| InChI | InChI=1S/C20H20N2O6S2/c1-3-29(25,26)18-16(17(23)13-8-6-5-7-9-13)15-11-10-14(19(21)24)12-22(15)20(18)30(27,28)4-2/h5-12H,3-4H2,1-2H3,(H2,21,24) |
| InChIKey | DCPOPAZTIYPPTG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 132.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide?
The IUPAC name of 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide (CID 1399053) is 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide.
What is the SMILES notation for 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide?
The canonical SMILES for 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide is CCS(=O)(=O)c1c(C(=O)c2ccccc2)c2ccc(C(N)=O)cn2c1S(=O)(=O)CC.
What is the InChIKey of 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide?
The InChIKey is DCPOPAZTIYPPTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O6S2/c1-3-29(25,26)18-16(17(23)13-8-6-5-7-9-13)15-11-10-14(19(21)24)12-22(15)20(18)30(27,28)4-2/h5-12H,3-4H2,1-2H3,(H2,21,24).
What are the key properties of 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide?
1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide has a molecular weight of 448.52 g/mol, XLogP of 1.86, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzoyl-2,3-bis(ethylsulfonyl)indolizine-6-carboxamide is sourced from PubChem (CID 1399053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).