About methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate
methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate (PubChem CID 139905906) has the molecular formula C8H8Cl2O3
and a molecular weight of 223.05 g/mol. Its IUPAC name is methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 139905906 |
| Molecular Formula | C8H8Cl2O3 |
| Molecular Weight | 223.05 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(Cl)CC(O)(Cl)C=C1 |
| InChI | InChI=1S/C8H8Cl2O3/c1-13-7(11)5-2-3-8(10,12)4-6(5)9/h2-3,12H,4H2,1H3 |
| InChIKey | ZGRUIIXVHDUOOA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.05 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate (CID 139905906) is methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate is COC(=O)C1=C(Cl)CC(O)(Cl)C=C1.
What is the InChIKey of methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate?
The InChIKey is ZGRUIIXVHDUOOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2O3/c1-13-7(11)5-2-3-8(10,12)4-6(5)9/h2-3,12H,4H2,1H3.
What are the key properties of methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate?
methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate has a molecular weight of 223.05 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dichloro-4-hydroxycyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 139905906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).