C33H46FN — CID 139906171
5-[(7R,8S,9S,11S,13S,14S)-11-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-N-methyl-N-[2-(4-methylphenyl)ethyl]pentan-1-amine (PubChem CID 139906171) has the molecular formula C33H46FN and a molecular weight of 475.74 g/mol. Its IUPAC name is 5-[(7R,8S,9S,11S,13S,14S)-11-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-N-methyl-N-[2-(4-methylphenyl)ethyl]pentan-1-amine.
| Compound Name | 5-[(7R,8S,9S,11S,13S,14S)-11-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-N-methyl-N-[2-(4-methylphenyl)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 139906171 |
| Molecular Formula | C33H46FN |
| Molecular Weight | 475.74 g/mol |
| Exact Mass | 475.36 |
| IUPAC Name | 5-[(7R,8S,9S,11S,13S,14S)-11-fluoro-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-N-methyl-N-[2-(4-methylphenyl)ethyl]pentan-1-amine |
| SMILES | Cc1ccc(CCN(C)CCCCC[C@@H]2Cc3ccccc3[C@@H]3[C@@H]2[C@@H]2CCC[C@@]2(C)C[C@@H]3F)cc1 |
| InChI | InChI=1S/C33H46FN/c1-24-14-16-25(17-15-24)18-21-35(3)20-8-4-5-11-27-22-26-10-6-7-12-28(26)32-30(34)23-33(2)19-9-13-29(33)31(27)32/h6-7,10,12,14-17,27,29-32H,4-5,8-9,11,13,18-23H2,1-3H3/t27-,29+,30+,31+,32+,33+/m1/s1 |
| InChIKey | ZYAOQYFBNAWXNE-GGCMZBLWSA-N |
| XLogP | 8.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.74 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|