About 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid
2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid (PubChem CID 139906214) has the molecular formula C20H30N2O6S
and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid |
| PubChem CID | 139906214 |
| Molecular Formula | C20H30N2O6S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCCN(CCN1CCC(C(=O)O)C1c1ccc2c(c1)OCO2)S(=O)(=O)CCC |
| InChI | InChI=1S/C20H30N2O6S/c1-3-8-22(29(25,26)12-4-2)11-10-21-9-7-16(20(23)24)19(21)15-5-6-17-18(13-15)28-14-27-17/h5-6,13,16,19H,3-4,7-12,14H2,1-2H3,(H,23,24) |
| InChIKey | WLQCATIWYVXMLI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid (CID 139906214) is 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid is CCCN(CCN1CCC(C(=O)O)C1c1ccc2c(c1)OCO2)S(=O)(=O)CCC.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid?
The InChIKey is WLQCATIWYVXMLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2O6S/c1-3-8-22(29(25,26)12-4-2)11-10-21-9-7-16(20(23)24)19(21)15-5-6-17-18(13-15)28-14-27-17/h5-6,13,16,19H,3-4,7-12,14H2,1-2H3,(H,23,24).
What are the key properties of 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid?
2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid has a molecular weight of 426.54 g/mol, XLogP of 2.31, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-1-[2-[propyl(propylsulfonyl)amino]ethyl]pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 139906214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).