C4HCl3F4 — CID 139906496
2,4,4-trichloro-1,1,1,3-tetrafluorobut-2-ene (PubChem CID 139906496) has the molecular formula C4HCl3F4 and a molecular weight of 231.40 g/mol. Its IUPAC name is 2,4,4-trichloro-1,1,1,3-tetrafluorobut-2-ene.
| Compound Name | 2,4,4-trichloro-1,1,1,3-tetrafluorobut-2-ene |
|---|---|
| PubChem CID | 139906496 |
| Molecular Formula | C4HCl3F4 |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 229.91 |
| IUPAC Name | 2,4,4-trichloro-1,1,1,3-tetrafluorobut-2-ene |
| SMILES | FC(=C(Cl)C(F)(F)F)C(Cl)Cl |
| InChI | InChI=1S/C4HCl3F4/c5-2(4(9,10)11)1(8)3(6)7/h3H |
| InChIKey | MUWCCAYZGZQNGK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|