C5HClF6 — CID 139906497
1-chloro-2,3,3,4,5,5-hexafluorocyclopentene (PubChem CID 139906497) has the molecular formula C5HClF6 and a molecular weight of 210.50 g/mol. Its IUPAC name is 1-chloro-2,3,3,4,5,5-hexafluorocyclopentene.
| Compound Name | 1-chloro-2,3,3,4,5,5-hexafluorocyclopentene |
|---|---|
| PubChem CID | 139906497 |
| Molecular Formula | C5HClF6 |
| Molecular Weight | 210.50 g/mol |
| Exact Mass | 209.97 |
| IUPAC Name | 1-chloro-2,3,3,4,5,5-hexafluorocyclopentene |
| SMILES | FC1=C(Cl)C(F)(F)C(F)C1(F)F |
| InChI | InChI=1S/C5HClF6/c6-1-2(7)5(11,12)3(8)4(1,9)10/h3H |
| InChIKey | VIKYVGPOIJUFPB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |