C9H9F5N2OS — CID 139907811
3-ethyl-2-methylsulfanyl-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-one (PubChem CID 139907811) has the molecular formula C9H9F5N2OS and a molecular weight of 288.24 g/mol. Its IUPAC name is 3-ethyl-2-methylsulfanyl-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-one.
| Compound Name | 3-ethyl-2-methylsulfanyl-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 139907811 |
| Molecular Formula | C9H9F5N2OS |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 3-ethyl-2-methylsulfanyl-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-one |
| SMILES | CCn1c(SC)nc(C(F)(F)C(F)(F)F)cc1=O |
| InChI | InChI=1S/C9H9F5N2OS/c1-3-16-6(17)4-5(15-7(16)18-2)8(10,11)9(12,13)14/h4H,3H2,1-2H3 |
| InChIKey | TXAGBACHZUZWIZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|