C43H44O8 — CID 139908346
[4-[3-[4-[(E)-3-[4-(2,2-dimethylpropoxy)phenyl]prop-2-enoyl]oxyphenyl]-3-oxopropanoyl]phenyl] (E)-3-[4-(2,2-dimethylpropoxy)phenyl]prop-2-enoate (PubChem CID 139908346) has the molecular formula C43H44O8 and a molecular weight of 688.82 g/mol. Its IUPAC name is [4-[3-[4-[(E)-3-[4-(2,2-dimethylpropoxy)phenyl]prop-2-enoyl]oxyphenyl]-3-oxopropanoyl]phenyl] (E)-3-[4-(2,2-dimethylpropoxy)phenyl]prop-2-enoate.
| Compound Name | [4-[3-[4-[(E)-3-[4-(2,2-dimethylpropoxy)phenyl]prop-2-enoyl]oxyphenyl]-3-oxopropanoyl]phenyl] (E)-3-[4-(2,2-dimethylpropoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 139908346 |
| Molecular Formula | C43H44O8 |
| Molecular Weight | 688.82 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | [4-[3-[4-[(E)-3-[4-(2,2-dimethylpropoxy)phenyl]prop-2-enoyl]oxyphenyl]-3-oxopropanoyl]phenyl] (E)-3-[4-(2,2-dimethylpropoxy)phenyl]prop-2-enoate |
| SMILES | CC(C)(C)COc1ccc(/C=C/C(=O)Oc2ccc(C(=O)CC(=O)c3ccc(OC(=O)/C=C/c4ccc(OCC(C)(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C43H44O8/c1-42(2,3)28-48-34-17-7-30(8-18-34)11-25-40(46)50-36-21-13-32(14-22-36)38(44)27-39(45)33-15-23-37(24-16-33)51-41(47)26-12-31-9-19-35(20-10-31)49-29-43(4,5)6/h7-26H,27-29H2,1-6H3/b25-11+,26-12+ |
| InChIKey | JUVBOAUNFBJWSQ-KOZSXFMUSA-N |
| XLogP | 9.23 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.82 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|