C11H5F15O2 — CID 139908405
2-[2,2,3,3,3-pentafluoro-1-[3,3,4,4,4-pentafluoro-2-(1,1,2,2,2-pentafluoroethyl)but-1-enoxy]propyl]oxirane (PubChem CID 139908405) has the molecular formula C11H5F15O2 and a molecular weight of 454.13 g/mol. Its IUPAC name is 2-[2,2,3,3,3-pentafluoro-1-[3,3,4,4,4-pentafluoro-2-(1,1,2,2,2-pentafluoroethyl)but-1-enoxy]propyl]oxirane.
| Compound Name | 2-[2,2,3,3,3-pentafluoro-1-[3,3,4,4,4-pentafluoro-2-(1,1,2,2,2-pentafluoroethyl)but-1-enoxy]propyl]oxirane |
|---|---|
| PubChem CID | 139908405 |
| Molecular Formula | C11H5F15O2 |
| Molecular Weight | 454.13 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 2-[2,2,3,3,3-pentafluoro-1-[3,3,4,4,4-pentafluoro-2-(1,1,2,2,2-pentafluoroethyl)but-1-enoxy]propyl]oxirane |
| SMILES | FC(F)(F)C(F)(F)C(=COC(C1CO1)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F15O2/c12-6(13,9(18,19)20)4(7(14,15)10(21,22)23)2-28-5(3-1-27-3)8(16,17)11(24,25)26/h2-3,5H,1H2 |
| InChIKey | JAXHUCUFOWCORA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.13 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|