C10H19NO2 — CID 139908446
N-(4-hydroxy-3,3-dimethylbutan-2-yl)-2-methylprop-2-enamide (PubChem CID 139908446) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is N-(4-hydroxy-3,3-dimethylbutan-2-yl)-2-methylprop-2-enamide.
| Compound Name | N-(4-hydroxy-3,3-dimethylbutan-2-yl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 139908446 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N-(4-hydroxy-3,3-dimethylbutan-2-yl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(C)C(C)(C)CO |
| InChI | InChI=1S/C10H19NO2/c1-7(2)9(13)11-8(3)10(4,5)6-12/h8,12H,1,6H2,2-5H3,(H,11,13) |
| InChIKey | QWFGEBPYOWVIOE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|