C14H12N6O6S4 — CID 139909660
5-[(3,4,5-tricarbamoylthiophen-2-yl)disulfanyl]thiophene-2,3,4-tricarboxamide (PubChem CID 139909660) has the molecular formula C14H12N6O6S4 and a molecular weight of 488.55 g/mol. Its IUPAC name is 5-[(3,4,5-tricarbamoylthiophen-2-yl)disulfanyl]thiophene-2,3,4-tricarboxamide.
| Compound Name | 5-[(3,4,5-tricarbamoylthiophen-2-yl)disulfanyl]thiophene-2,3,4-tricarboxamide |
|---|---|
| PubChem CID | 139909660 |
| Molecular Formula | C14H12N6O6S4 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | 5-[(3,4,5-tricarbamoylthiophen-2-yl)disulfanyl]thiophene-2,3,4-tricarboxamide |
| SMILES | NC(=O)c1sc(SSc2sc(C(N)=O)c(C(N)=O)c2C(N)=O)c(C(N)=O)c1C(N)=O |
| InChI | InChI=1S/C14H12N6O6S4/c15-7(21)1-3(9(17)23)13(27-5(1)11(19)25)29-30-14-4(10(18)24)2(8(16)22)6(28-14)12(20)26/h(H2,15,21)(H2,16,22)(H2,17,23)(H2,18,24)(H2,19,25)(H2,20,26) |
| InChIKey | XOPHGOZIPRDZDI-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 258.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|