C12H15NS — CID 139910111
3,4,5,6,7,10-hexahydro-2H-thiopyrano[3,2-b]quinoline (PubChem CID 139910111) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 3,4,5,6,7,10-hexahydro-2H-thiopyrano[3,2-b]quinoline.
| Compound Name | 3,4,5,6,7,10-hexahydro-2H-thiopyrano[3,2-b]quinoline |
|---|---|
| PubChem CID | 139910111 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3,4,5,6,7,10-hexahydro-2H-thiopyrano[3,2-b]quinoline |
| SMILES | C1=CC2=C(CC1)NC1=C(C2)SCCC1 |
| InChI | InChI=1S/C12H15NS/c1-2-5-10-9(4-1)8-12-11(13-10)6-3-7-14-12/h1,4,13H,2-3,5-8H2 |
| InChIKey | BLDTVNSVUCNWTK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |