About [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane
[2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane (PubChem CID 139910843) has the molecular formula C25H38OSi
and a molecular weight of 382.66 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane.
Molecular Properties
| Compound Name | [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane |
| PubChem CID | 139910843 |
| Molecular Formula | C25H38OSi |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane |
| SMILES | Cc1ccc(-c2cc(C(C)(C)C)c(O[Si](C)(C)C)c(C(C)(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C25H38OSi/c1-17-12-13-20(18(2)14-17)19-15-21(24(3,4)5)23(26-27(9,10)11)22(16-19)25(6,7)8/h12-16H,1-11H3 |
| InChIKey | WEXYPFYRWAIODZ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane?
The IUPAC name of [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane (CID 139910843) is [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane.
What is the SMILES notation for [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane?
The canonical SMILES for [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane is Cc1ccc(-c2cc(C(C)(C)C)c(O[Si](C)(C)C)c(C(C)(C)C)c2)c(C)c1.
What is the InChIKey of [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane?
The InChIKey is WEXYPFYRWAIODZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H38OSi/c1-17-12-13-20(18(2)14-17)19-15-21(24(3,4)5)23(26-27(9,10)11)22(16-19)25(6,7)8/h12-16H,1-11H3.
What are the key properties of [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane?
[2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane has a molecular weight of 382.66 g/mol, XLogP of 7.78, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-ditert-butyl-4-(2,4-dimethylphenyl)phenoxy]-trimethylsilane is sourced from PubChem (CID 139910843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).