About 2,2-dichloroethyl N-ethylcarbamate
2,2-dichloroethyl N-ethylcarbamate (PubChem CID 139910857) has the molecular formula C5H9Cl2NO2
and a molecular weight of 186.04 g/mol. Its IUPAC name is 2,2-dichloroethyl N-ethylcarbamate.
Molecular Properties
| Compound Name | 2,2-dichloroethyl N-ethylcarbamate |
| PubChem CID | 139910857 |
| Molecular Formula | C5H9Cl2NO2 |
| Molecular Weight | 186.04 g/mol |
| Exact Mass | 185.00 |
| IUPAC Name | 2,2-dichloroethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCC(Cl)Cl |
| InChI | InChI=1S/C5H9Cl2NO2/c1-2-8-5(9)10-3-4(6)7/h4H,2-3H2,1H3,(H,8,9) |
| InChIKey | SILKHDTVWNRKRU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.04 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloroethyl N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloroethyl N-ethylcarbamate?
The IUPAC name of 2,2-dichloroethyl N-ethylcarbamate (CID 139910857) is 2,2-dichloroethyl N-ethylcarbamate.
What is the SMILES notation for 2,2-dichloroethyl N-ethylcarbamate?
The canonical SMILES for 2,2-dichloroethyl N-ethylcarbamate is CCNC(=O)OCC(Cl)Cl.
What is the InChIKey of 2,2-dichloroethyl N-ethylcarbamate?
The InChIKey is SILKHDTVWNRKRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9Cl2NO2/c1-2-8-5(9)10-3-4(6)7/h4H,2-3H2,1H3,(H,8,9).
What are the key properties of 2,2-dichloroethyl N-ethylcarbamate?
2,2-dichloroethyl N-ethylcarbamate has a molecular weight of 186.04 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloroethyl N-ethylcarbamate is sourced from PubChem (CID 139910857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).