About propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate
propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate (PubChem CID 139911319) has the molecular formula C14H14F3NO2
and a molecular weight of 285.27 g/mol. Its IUPAC name is propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate |
| PubChem CID | 139911319 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate |
| SMILES | CC(C)OC(=O)C1=Cc2ccccc2NC1C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO2/c1-8(2)20-13(19)10-7-9-5-3-4-6-11(9)18-12(10)14(15,16)17/h3-8,12,18H,1-2H3 |
| InChIKey | GVJIAIFKVIPVGE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate?
The IUPAC name of propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate (CID 139911319) is propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate.
What is the SMILES notation for propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate?
The canonical SMILES for propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate is CC(C)OC(=O)C1=Cc2ccccc2NC1C(F)(F)F.
What is the InChIKey of propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate?
The InChIKey is GVJIAIFKVIPVGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3NO2/c1-8(2)20-13(19)10-7-9-5-3-4-6-11(9)18-12(10)14(15,16)17/h3-8,12,18H,1-2H3.
What are the key properties of propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate?
propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate has a molecular weight of 285.27 g/mol, XLogP of 3.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(trifluoromethyl)-1,2-dihydroquinoline-3-carboxylate is sourced from PubChem (CID 139911319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).