C19H25N3O2S — CID 139911674
N-cyclohexyl-N,3,6-trimethyl-5-[(E)-2-methyl-3-oxoprop-1-enyl]imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 139911674) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-cyclohexyl-N,3,6-trimethyl-5-[(E)-2-methyl-3-oxoprop-1-enyl]imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | N-cyclohexyl-N,3,6-trimethyl-5-[(E)-2-methyl-3-oxoprop-1-enyl]imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 139911674 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-cyclohexyl-N,3,6-trimethyl-5-[(E)-2-methyl-3-oxoprop-1-enyl]imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | C/C(C=O)=C\c1c(C)nc2sc(C(=O)N(C)C3CCCCC3)c(C)n12 |
| InChI | InChI=1S/C19H25N3O2S/c1-12(11-23)10-16-13(2)20-19-22(16)14(3)17(25-19)18(24)21(4)15-8-6-5-7-9-15/h10-11,15H,5-9H2,1-4H3/b12-10+ |
| InChIKey | UKGCYDXGHBQFNJ-ZRDIBKRKSA-N |
| XLogP | 4.02 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|