C12H20N2O — CID 139911811
N-[(4Z,8Z)-2-aminocyclododeca-4,8-dien-1-ylidene]hydroxylamine (PubChem CID 139911811) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is N-[(4Z,8Z)-2-aminocyclododeca-4,8-dien-1-ylidene]hydroxylamine.
| Compound Name | N-[(4Z,8Z)-2-aminocyclododeca-4,8-dien-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 139911811 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-[(4Z,8Z)-2-aminocyclododeca-4,8-dien-1-ylidene]hydroxylamine |
| SMILES | NC1C/C=C\CC/C=C\CCCC1=NO |
| InChI | InChI=1S/C12H20N2O/c13-11-9-7-5-3-1-2-4-6-8-10-12(11)14-15/h2,4-5,7,11,15H,1,3,6,8-10,13H2/b4-2-,7-5-,14-12? |
| InChIKey | ZXYJJNIPGJPROH-QSDZGCEFSA-N |
| XLogP | 2.61 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|