C29H25F5O5S2 — CID 139913095
[bis(4-ethoxyphenyl)-(4-methylphenyl)-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 139913095) has the molecular formula C29H25F5O5S2 and a molecular weight of 612.64 g/mol. Its IUPAC name is [bis(4-ethoxyphenyl)-(4-methylphenyl)-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [bis(4-ethoxyphenyl)-(4-methylphenyl)-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 139913095 |
| Molecular Formula | C29H25F5O5S2 |
| Molecular Weight | 612.64 g/mol |
| Exact Mass | 612.11 |
| IUPAC Name | [bis(4-ethoxyphenyl)-(4-methylphenyl)-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | CCOc1ccc(S(OS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)(c2ccc(C)cc2)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C29H25F5O5S2/c1-4-37-19-8-14-22(15-9-19)40(21-12-6-18(3)7-13-21,23-16-10-20(11-17-23)38-5-2)39-41(35,36)29-27(33)25(31)24(30)26(32)28(29)34/h6-17H,4-5H2,1-3H3 |
| InChIKey | VFBJQOOTYBPTKX-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.64 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|