About 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate
4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate (PubChem CID 139913181) has the molecular formula C15H17NO5S
and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate |
| PubChem CID | 139913181 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C15H17NO5S/c1-12-4-6-13(7-5-12)22(19,20)21-11-3-2-10-16-14(17)8-9-15(16)18/h4-9H,2-3,10-11H2,1H3 |
| InChIKey | IKSRUPSVORDMDF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate?
The IUPAC name of 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate (CID 139913181) is 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate.
What is the SMILES notation for 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate?
The canonical SMILES for 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCCCN2C(=O)C=CC2=O)cc1.
What is the InChIKey of 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate?
The InChIKey is IKSRUPSVORDMDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO5S/c1-12-4-6-13(7-5-12)22(19,20)21-11-3-2-10-16-14(17)8-9-15(16)18/h4-9H,2-3,10-11H2,1H3.
What are the key properties of 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate?
4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate has a molecular weight of 323.37 g/mol, XLogP of 1.41, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dioxopyrrol-1-yl)butyl 4-methylbenzenesulfonate is sourced from PubChem (CID 139913181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).