About bis(2,2-dimethylpropylperoxy) carbonate
bis(2,2-dimethylpropylperoxy) carbonate (PubChem CID 139913345) has the molecular formula C11H22O7
and a molecular weight of 266.29 g/mol. Its IUPAC name is bis(2,2-dimethylpropylperoxy) carbonate.
Molecular Properties
| Compound Name | bis(2,2-dimethylpropylperoxy) carbonate |
| PubChem CID | 139913345 |
| Molecular Formula | C11H22O7 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | bis(2,2-dimethylpropylperoxy) carbonate |
| SMILES | CC(C)(C)COOOC(=O)OOOCC(C)(C)C |
| InChI | InChI=1S/C11H22O7/c1-10(2,3)7-13-17-15-9(12)16-18-14-8-11(4,5)6/h7-8H2,1-6H3 |
| InChIKey | KQTHCXXMGXHOOP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze bis(2,2-dimethylpropylperoxy) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2-dimethylpropylperoxy) carbonate?
The IUPAC name of bis(2,2-dimethylpropylperoxy) carbonate (CID 139913345) is bis(2,2-dimethylpropylperoxy) carbonate.
What is the SMILES notation for bis(2,2-dimethylpropylperoxy) carbonate?
The canonical SMILES for bis(2,2-dimethylpropylperoxy) carbonate is CC(C)(C)COOOC(=O)OOOCC(C)(C)C.
What is the InChIKey of bis(2,2-dimethylpropylperoxy) carbonate?
The InChIKey is KQTHCXXMGXHOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O7/c1-10(2,3)7-13-17-15-9(12)16-18-14-8-11(4,5)6/h7-8H2,1-6H3.
What are the key properties of bis(2,2-dimethylpropylperoxy) carbonate?
bis(2,2-dimethylpropylperoxy) carbonate has a molecular weight of 266.29 g/mol, XLogP of 2.96, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2-dimethylpropylperoxy) carbonate is sourced from PubChem (CID 139913345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).