About [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate
[4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate (PubChem CID 139913447) has the molecular formula C18H24O3SSi
and a molecular weight of 348.54 g/mol. Its IUPAC name is [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate.
Molecular Properties
| Compound Name | [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate |
| PubChem CID | 139913447 |
| Molecular Formula | C18H24O3SSi |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate |
| SMILES | CC(=O)Oc1cc(C)c(OC[Si](C)(C)c2cccs2)c(C)c1C |
| InChI | InChI=1S/C18H24O3SSi/c1-12-10-16(21-15(4)19)13(2)14(3)18(12)20-11-23(5,6)17-8-7-9-22-17/h7-10H,11H2,1-6H3 |
| InChIKey | CABTUBCLWWFHAC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate?
The IUPAC name of [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate (CID 139913447) is [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate.
What is the SMILES notation for [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate?
The canonical SMILES for [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate is CC(=O)Oc1cc(C)c(OC[Si](C)(C)c2cccs2)c(C)c1C.
What is the InChIKey of [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate?
The InChIKey is CABTUBCLWWFHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O3SSi/c1-12-10-16(21-15(4)19)13(2)14(3)18(12)20-11-23(5,6)17-8-7-9-22-17/h7-10H,11H2,1-6H3.
What are the key properties of [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate?
[4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate has a molecular weight of 348.54 g/mol, XLogP of 4.13, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[dimethyl(thiophen-2-yl)silyl]methoxy]-2,3,5-trimethylphenyl] acetate is sourced from PubChem (CID 139913447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).