About azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride
azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride (PubChem CID 139913522) has the molecular formula C8H20ClN3O
and a molecular weight of 209.72 g/mol. Its IUPAC name is azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride.
Molecular Properties
| Compound Name | azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride |
| PubChem CID | 139913522 |
| Molecular Formula | C8H20ClN3O |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride |
| SMILES | CN1C2CCC1CC(NO)C2.Cl.N |
| InChI | InChI=1S/C8H16N2O.ClH.H3N/c1-10-7-2-3-8(10)5-6(4-7)9-11;;/h6-9,11H,2-5H2,1H3;1H;1H3 |
| InChIKey | SANCYOMTUZHZOB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride?
The IUPAC name of azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride (CID 139913522) is azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride.
What is the SMILES notation for azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride?
The canonical SMILES for azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride is CN1C2CCC1CC(NO)C2.Cl.N.
What is the InChIKey of azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride?
The InChIKey is SANCYOMTUZHZOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.ClH.H3N/c1-10-7-2-3-8(10)5-6(4-7)9-11;;/h6-9,11H,2-5H2,1H3;1H;1H3.
What are the key properties of azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride?
azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride has a molecular weight of 209.72 g/mol, XLogP of 1.17, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)hydroxylamine;hydrochloride is sourced from PubChem (CID 139913522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).