About (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate
(1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate (PubChem CID 139914202) has the molecular formula C21H29NO7S2
and a molecular weight of 471.60 g/mol. Its IUPAC name is (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate.
Molecular Properties
| Compound Name | (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate |
| PubChem CID | 139914202 |
| Molecular Formula | C21H29NO7S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate |
| SMILES | CCOS(=O)(=O)[O-].CC[N+]1(C(c2ccccc2)c2ccccc2)CC(OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C19H24NO3S.C2H6O4S/c1-3-20(14-18(15-20)23-24(2,21)22)19(16-10-6-4-7-11-16)17-12-8-5-9-13-17;1-2-6-7(3,4)5/h4-13,18-19H,3,14-15H2,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | OXNXAPORZPEXLR-UHFFFAOYSA-M |
| XLogP | 2.45 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate?
The IUPAC name of (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate (CID 139914202) is (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate.
What is the SMILES notation for (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate?
The canonical SMILES for (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate is CCOS(=O)(=O)[O-].CC[N+]1(C(c2ccccc2)c2ccccc2)CC(OS(C)(=O)=O)C1.
What is the InChIKey of (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate?
The InChIKey is OXNXAPORZPEXLR-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H24NO3S.C2H6O4S/c1-3-20(14-18(15-20)23-24(2,21)22)19(16-10-6-4-7-11-16)17-12-8-5-9-13-17;1-2-6-7(3,4)5/h4-13,18-19H,3,14-15H2,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1.
What are the key properties of (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate?
(1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate has a molecular weight of 471.60 g/mol, XLogP of 2.45, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzhydryl-1-ethylazetidin-1-ium-3-yl) methanesulfonate;ethyl sulfate is sourced from PubChem (CID 139914202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).