C30H54O3 — CID 139914246
2,3,3-trimethyldodec-11-enoyl 2,3,3-trimethyldodec-11-enoate (PubChem CID 139914246) has the molecular formula C30H54O3 and a molecular weight of 462.76 g/mol. Its IUPAC name is 2,3,3-trimethyldodec-11-enoyl 2,3,3-trimethyldodec-11-enoate.
| Compound Name | 2,3,3-trimethyldodec-11-enoyl 2,3,3-trimethyldodec-11-enoate |
|---|---|
| PubChem CID | 139914246 |
| Molecular Formula | C30H54O3 |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 462.41 |
| IUPAC Name | 2,3,3-trimethyldodec-11-enoyl 2,3,3-trimethyldodec-11-enoate |
| SMILES | C=CCCCCCCCC(C)(C)C(C)C(=O)OC(=O)C(C)C(C)(C)CCCCCCCC=C |
| InChI | InChI=1S/C30H54O3/c1-9-11-13-15-17-19-21-23-29(5,6)25(3)27(31)33-28(32)26(4)30(7,8)24-22-20-18-16-14-12-10-2/h9-10,25-26H,1-2,11-24H2,3-8H3 |
| InChIKey | KBAZBKKHBMQFIG-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|