C22H19F4N3O6 — CID 139914652
ethyl 2-[[3-[2-amino-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3H-pyridin-1-yl]phenoxy]-2-pyridinyl]oxy]acetate (PubChem CID 139914652) has the molecular formula C22H19F4N3O6 and a molecular weight of 497.40 g/mol. Its IUPAC name is ethyl 2-[[3-[2-amino-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3H-pyridin-1-yl]phenoxy]-2-pyridinyl]oxy]acetate.
| Compound Name | ethyl 2-[[3-[2-amino-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3H-pyridin-1-yl]phenoxy]-2-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 139914652 |
| Molecular Formula | C22H19F4N3O6 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | ethyl 2-[[3-[2-amino-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3H-pyridin-1-yl]phenoxy]-2-pyridinyl]oxy]acetate |
| SMILES | CCOC(=O)COc1ncccc1Oc1cc(N2C(=O)C=C(C(F)(F)F)C(C)C2=O)c(F)cc1N |
| InChI | InChI=1S/C22H19F4N3O6/c1-3-33-19(31)10-34-20-16(5-4-6-28-20)35-17-9-15(13(23)8-14(17)27)29-18(30)7-12(22(24,25)26)11(2)21(29)32/h4-9,11H,3,10,27H2,1-2H3 |
| InChIKey | OSLAQQWZFYGYMF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|