C28H21F6N3O2 — CID 139914726
2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-12-(4-methylphenyl)-4,5-dihydro-3H-[1,4]diazepino[1,2-b][2,7]naphthyridine-1,7-dione (PubChem CID 139914726) has the molecular formula C28H21F6N3O2 and a molecular weight of 545.48 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-12-(4-methylphenyl)-4,5-dihydro-3H-[1,4]diazepino[1,2-b][2,7]naphthyridine-1,7-dione.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-12-(4-methylphenyl)-4,5-dihydro-3H-[1,4]diazepino[1,2-b][2,7]naphthyridine-1,7-dione |
|---|---|
| PubChem CID | 139914726 |
| Molecular Formula | C28H21F6N3O2 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-12-(4-methylphenyl)-4,5-dihydro-3H-[1,4]diazepino[1,2-b][2,7]naphthyridine-1,7-dione |
| SMILES | Cc1ccc(-c2c3n(c(=O)c4cnccc24)CCCN(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C3=O)cc1 |
| InChI | InChI=1S/C28H21F6N3O2/c1-16-3-5-18(6-4-16)23-21-7-8-35-14-22(21)25(38)37-10-2-9-36(26(39)24(23)37)15-17-11-19(27(29,30)31)13-20(12-17)28(32,33)34/h3-8,11-14H,2,9-10,15H2,1H3 |
| InChIKey | WGERMTMGOAGZOM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |