About 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine
6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine (PubChem CID 139915474) has the molecular formula C15H10BrClF2N2O2
and a molecular weight of 403.61 g/mol. Its IUPAC name is 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine.
Molecular Properties
| Compound Name | 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine |
| PubChem CID | 139915474 |
| Molecular Formula | C15H10BrClF2N2O2 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine |
| SMILES | [O-][n+]1ccccc1C1=NC(CF)(CF)Oc2cc(Cl)c(Br)cc21 |
| InChI | InChI=1S/C15H10BrClF2N2O2/c16-10-5-9-13(6-11(10)17)23-15(7-18,8-19)20-14(9)12-3-1-2-4-21(12)22/h1-6H,7-8H2 |
| InChIKey | CRSCSSDCSNZTEQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine?
The IUPAC name of 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine (CID 139915474) is 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine.
What is the SMILES notation for 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine?
The canonical SMILES for 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine is [O-][n+]1ccccc1C1=NC(CF)(CF)Oc2cc(Cl)c(Br)cc21.
What is the InChIKey of 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine?
The InChIKey is CRSCSSDCSNZTEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrClF2N2O2/c16-10-5-9-13(6-11(10)17)23-15(7-18,8-19)20-14(9)12-3-1-2-4-21(12)22/h1-6H,7-8H2.
What are the key properties of 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine?
6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine has a molecular weight of 403.61 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine is sourced from PubChem (CID 139915474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).