C15H10BrClF2N2O2 — CID 139915474
6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine (PubChem CID 139915474) has the molecular formula C15H10BrClF2N2O2 and a molecular weight of 403.61 g/mol. Its IUPAC name is 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine.
| Compound Name | 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine |
|---|---|
| PubChem CID | 139915474 |
| Molecular Formula | C15H10BrClF2N2O2 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 6-bromo-7-chloro-2,2-bis(fluoromethyl)-4-(1-oxidopyridin-1-ium-2-yl)-1,3-benzoxazine |
| SMILES | [O-][n+]1ccccc1C1=NC(CF)(CF)Oc2cc(Cl)c(Br)cc21 |
| InChI | InChI=1S/C15H10BrClF2N2O2/c16-10-5-9-13(6-11(10)17)23-15(7-18,8-19)20-14(9)12-3-1-2-4-21(12)22/h1-6H,7-8H2 |
| InChIKey | CRSCSSDCSNZTEQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|