C31H54O11 — CID 139915945
2-[2-[(E)-2-methyl-3-(2,3,3-trimethylpentan-2-ylperoxy)prop-2-enoyl]oxypropan-2-yloxycarbonyloxy]propan-2-yl (E)-2-methyl-3-(2,3,3-trimethylpentan-2-ylperoxy)prop-2-enoate (PubChem CID 139915945) has the molecular formula C31H54O11 and a molecular weight of 602.76 g/mol. Its IUPAC name is 2-[2-[(E)-2-methyl-3-(2,3,3-trimethylpentan-2-ylperoxy)prop-2-enoyl]oxypropan-2-yloxycarbonyloxy]propan-2-yl (E)-2-methyl-3-(2,3,3-trimethylpentan-2-ylperoxy)prop-2-enoate.
| Compound Name | 2-[2-[(E)-2-methyl-3-(2,3,3-trimethylpentan-2-ylperoxy)prop-2-enoyl]oxypropan-2-yloxycarbonyloxy]propan-2-yl (E)-2-methyl-3-(2,3,3-trimethylpentan-2-ylperoxy)prop-2-enoate |
|---|---|
| PubChem CID | 139915945 |
| Molecular Formula | C31H54O11 |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 602.37 |
| IUPAC Name | 2-[2-[(E)-2-methyl-3-(2,3,3-trimethylpentan-2-ylperoxy)prop-2-enoyl]oxypropan-2-yloxycarbonyloxy]propan-2-yl (E)-2-methyl-3-(2,3,3-trimethylpentan-2-ylperoxy)prop-2-enoate |
| SMILES | CCC(C)(C)C(C)(C)OO/C=C(\C)C(=O)OC(C)(C)OC(=O)OC(C)(C)OC(=O)/C(C)=C/OOC(C)(C)C(C)(C)CC |
| InChI | InChI=1S/C31H54O11/c1-17-26(5,6)28(9,10)41-35-19-21(3)23(32)37-30(13,14)39-25(34)40-31(15,16)38-24(33)22(4)20-36-42-29(11,12)27(7,8)18-2/h19-20H,17-18H2,1-16H3/b21-19+,22-20+ |
| InChIKey | FAWCEQNTOGVVRY-FLFKKZLDSA-N |
| XLogP | 7.83 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|