About 1-amino-9H-xanthene-3,9-diol
1-amino-9H-xanthene-3,9-diol (PubChem CID 139916598) has the molecular formula C13H11NO3
and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-amino-9H-xanthene-3,9-diol.
Molecular Properties
| Compound Name | 1-amino-9H-xanthene-3,9-diol |
| PubChem CID | 139916598 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1-amino-9H-xanthene-3,9-diol |
| SMILES | Nc1cc(O)cc2c1C(O)c1ccccc1O2 |
| InChI | InChI=1S/C13H11NO3/c14-9-5-7(15)6-11-12(9)13(16)8-3-1-2-4-10(8)17-11/h1-6,13,15-16H,14H2 |
| InChIKey | AKLMLMLBGUIYGE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-9H-xanthene-3,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-9H-xanthene-3,9-diol?
The IUPAC name of 1-amino-9H-xanthene-3,9-diol (CID 139916598) is 1-amino-9H-xanthene-3,9-diol.
What is the SMILES notation for 1-amino-9H-xanthene-3,9-diol?
The canonical SMILES for 1-amino-9H-xanthene-3,9-diol is Nc1cc(O)cc2c1C(O)c1ccccc1O2.
What is the InChIKey of 1-amino-9H-xanthene-3,9-diol?
The InChIKey is AKLMLMLBGUIYGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3/c14-9-5-7(15)6-11-12(9)13(16)8-3-1-2-4-10(8)17-11/h1-6,13,15-16H,14H2.
What are the key properties of 1-amino-9H-xanthene-3,9-diol?
1-amino-9H-xanthene-3,9-diol has a molecular weight of 229.24 g/mol, XLogP of 2.16, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-9H-xanthene-3,9-diol is sourced from PubChem (CID 139916598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).