About bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol
bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol (PubChem CID 139917472) has the molecular formula C10H11BrO3
and a molecular weight of 259.10 g/mol. Its IUPAC name is bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol.
Molecular Properties
| Compound Name | bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol |
| PubChem CID | 139917472 |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol |
| SMILES | OC(Br)c1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C10H11BrO3/c11-9(12)7-1-3-8(4-2-7)10-13-5-6-14-10/h1-4,9-10,12H,5-6H2 |
| InChIKey | OUJSNQMRCSVNAL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol?
The IUPAC name of bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol (CID 139917472) is bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol.
What is the SMILES notation for bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol?
The canonical SMILES for bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol is OC(Br)c1ccc(C2OCCO2)cc1.
What is the InChIKey of bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol?
The InChIKey is OUJSNQMRCSVNAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO3/c11-9(12)7-1-3-8(4-2-7)10-13-5-6-14-10/h1-4,9-10,12H,5-6H2.
What are the key properties of bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol?
bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol has a molecular weight of 259.10 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bromo-[4-(1,3-dioxolan-2-yl)phenyl]methanol is sourced from PubChem (CID 139917472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).