About [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid
[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid (PubChem CID 139917474) has the molecular formula C15H21BN2O8S
and a molecular weight of 400.22 g/mol. Its IUPAC name is [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid.
Molecular Properties
| Compound Name | [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid |
| PubChem CID | 139917474 |
| Molecular Formula | C15H21BN2O8S |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid |
| SMILES | COCCOCN(c1noc(C)c1C)S(=O)(=O)c1ccccc1OB(O)O |
| InChI | InChI=1S/C15H21BN2O8S/c1-11-12(2)26-17-15(11)18(10-24-9-8-23-3)27(21,22)14-7-5-4-6-13(14)25-16(19)20/h4-7,19-20H,8-10H2,1-3H3 |
| InChIKey | FORPGGPXPGFJEE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid?
The IUPAC name of [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid (CID 139917474) is [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid.
What is the SMILES notation for [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid?
The canonical SMILES for [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid is COCCOCN(c1noc(C)c1C)S(=O)(=O)c1ccccc1OB(O)O.
What is the InChIKey of [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid?
The InChIKey is FORPGGPXPGFJEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BN2O8S/c1-11-12(2)26-17-15(11)18(10-24-9-8-23-3)27(21,22)14-7-5-4-6-13(14)25-16(19)20/h4-7,19-20H,8-10H2,1-3H3.
What are the key properties of [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid?
[2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid has a molecular weight of 400.22 g/mol, XLogP of 0.46, 10 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4,5-dimethyl-1,2-oxazol-3-yl)-(2-methoxyethoxymethyl)sulfamoyl]phenoxy]boronic acid is sourced from PubChem (CID 139917474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).