C27H24F3N3O7 — CID 139917712
3-[5-(trifluoromethyl)-2-[3-(2,3,6-trioxospiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-1'-yl)propoxymethyl]phenyl]benzonitrile (PubChem CID 139917712) has the molecular formula C27H24F3N3O7 and a molecular weight of 559.50 g/mol. Its IUPAC name is 3-[5-(trifluoromethyl)-2-[3-(2,3,6-trioxospiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-1'-yl)propoxymethyl]phenyl]benzonitrile.
| Compound Name | 3-[5-(trifluoromethyl)-2-[3-(2,3,6-trioxospiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-1'-yl)propoxymethyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 139917712 |
| Molecular Formula | C27H24F3N3O7 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 3-[5-(trifluoromethyl)-2-[3-(2,3,6-trioxospiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-1'-yl)propoxymethyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(C(F)(F)F)ccc2COCCCN2CCC3(CC2)OC(=O)N2OC(=O)C(=O)OC23)c1 |
| InChI | InChI=1S/C27H24F3N3O7/c28-27(29,30)20-6-5-19(21(14-20)18-4-1-3-17(13-18)15-31)16-37-12-2-9-32-10-7-26(8-11-32)24-33(25(36)39-26)40-23(35)22(34)38-24/h1,3-6,13-14,24H,2,7-12,16H2 |
| InChIKey | BGVCTYFUUIHCBF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 118.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|