C25H21F2N3O7 — CID 139917714
3-[2,6-difluoro-3-[2-(2,3,6-trioxospiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-1'-yl)ethoxymethyl]phenyl]benzonitrile (PubChem CID 139917714) has the molecular formula C25H21F2N3O7 and a molecular weight of 513.45 g/mol. Its IUPAC name is 3-[2,6-difluoro-3-[2-(2,3,6-trioxospiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-1'-yl)ethoxymethyl]phenyl]benzonitrile.
| Compound Name | 3-[2,6-difluoro-3-[2-(2,3,6-trioxospiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-1'-yl)ethoxymethyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 139917714 |
| Molecular Formula | C25H21F2N3O7 |
| Molecular Weight | 513.45 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 3-[2,6-difluoro-3-[2-(2,3,6-trioxospiro[8aH-[1,3]oxazolo[3,4-b][1,4,2]dioxazine-8,4'-piperidine]-1'-yl)ethoxymethyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2c(F)ccc(COCCN3CCC4(CC3)OC(=O)N3OC(=O)C(=O)OC34)c2F)c1 |
| InChI | InChI=1S/C25H21F2N3O7/c26-18-5-4-17(20(27)19(18)16-3-1-2-15(12-16)13-28)14-34-11-10-29-8-6-25(7-9-29)23-30(24(33)36-25)37-22(32)21(31)35-23/h1-5,12,23H,6-11,14H2 |
| InChIKey | ILDJQWRYQHZZIG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 118.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|