C10H7FN2O2 — CID 139918150
4-fluoro-2-(4-methyl-1,2,5-oxadiazol-3-yl)benzaldehyde (PubChem CID 139918150) has the molecular formula C10H7FN2O2 and a molecular weight of 206.18 g/mol. Its IUPAC name is 4-fluoro-2-(4-methyl-1,2,5-oxadiazol-3-yl)benzaldehyde.
| Compound Name | 4-fluoro-2-(4-methyl-1,2,5-oxadiazol-3-yl)benzaldehyde |
|---|---|
| PubChem CID | 139918150 |
| Molecular Formula | C10H7FN2O2 |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 4-fluoro-2-(4-methyl-1,2,5-oxadiazol-3-yl)benzaldehyde |
| SMILES | Cc1nonc1-c1cc(F)ccc1C=O |
| InChI | InChI=1S/C10H7FN2O2/c1-6-10(13-15-12-6)9-4-8(11)3-2-7(9)5-14/h2-5H,1H3 |
| InChIKey | CLNMQPKGNFPSQS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|