About 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline
3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline (PubChem CID 139919434) has the molecular formula C23H25IN2
and a molecular weight of 456.37 g/mol. Its IUPAC name is 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline |
| PubChem CID | 139919434 |
| Molecular Formula | C23H25IN2 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C(c2ccccc2)(c2ccccc2)N(C)C)c1I |
| InChI | InChI=1S/C23H25IN2/c1-25(2)21-17-11-16-20(22(21)24)23(26(3)4,18-12-7-5-8-13-18)19-14-9-6-10-15-19/h5-17H,1-4H3 |
| InChIKey | OPODGFSTCYNVEU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline?
The IUPAC name of 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline (CID 139919434) is 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline.
What is the SMILES notation for 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline?
The canonical SMILES for 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline is CN(C)c1cccc(C(c2ccccc2)(c2ccccc2)N(C)C)c1I.
What is the InChIKey of 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline?
The InChIKey is OPODGFSTCYNVEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25IN2/c1-25(2)21-17-11-16-20(22(21)24)23(26(3)4,18-12-7-5-8-13-18)19-14-9-6-10-15-19/h5-17H,1-4H3.
What are the key properties of 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline?
3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline has a molecular weight of 456.37 g/mol, XLogP of 5.21, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[dimethylamino(diphenyl)methyl]-2-iodo-N,N-dimethylaniline is sourced from PubChem (CID 139919434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).