About 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole
1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole (PubChem CID 139919703) has the molecular formula C22H34N6
and a molecular weight of 382.56 g/mol. Its IUPAC name is 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole |
| PubChem CID | 139919703 |
| Molecular Formula | C22H34N6 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole |
| SMILES | CCc1c(C)nn(C(n2nc(C)c(CC)c2C)n2nc(C)c(CC)c2C)c1C |
| InChI | InChI=1S/C22H34N6/c1-10-19-13(4)23-26(16(19)7)22(27-17(8)20(11-2)14(5)24-27)28-18(9)21(12-3)15(6)25-28/h22H,10-12H2,1-9H3 |
| InChIKey | YTWKUQNOZNQLCC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole?
The IUPAC name of 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole (CID 139919703) is 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole.
What is the SMILES notation for 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole?
The canonical SMILES for 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole is CCc1c(C)nn(C(n2nc(C)c(CC)c2C)n2nc(C)c(CC)c2C)c1C.
What is the InChIKey of 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole?
The InChIKey is YTWKUQNOZNQLCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34N6/c1-10-19-13(4)23-26(16(19)7)22(27-17(8)20(11-2)14(5)24-27)28-18(9)21(12-3)15(6)25-28/h22H,10-12H2,1-9H3.
What are the key properties of 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole?
1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole has a molecular weight of 382.56 g/mol, XLogP of 4.37, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-4-ethyl-3,5-dimethylpyrazole is sourced from PubChem (CID 139919703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).