C26H37NO8 — CID 139919779
[3-(2,6-dimethylphenyl)-8-(ethoxymethoxy)-1-(1-methoxyethoxy)-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate (PubChem CID 139919779) has the molecular formula C26H37NO8 and a molecular weight of 491.58 g/mol. Its IUPAC name is [3-(2,6-dimethylphenyl)-8-(ethoxymethoxy)-1-(1-methoxyethoxy)-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate.
| Compound Name | [3-(2,6-dimethylphenyl)-8-(ethoxymethoxy)-1-(1-methoxyethoxy)-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate |
|---|---|
| PubChem CID | 139919779 |
| Molecular Formula | C26H37NO8 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | [3-(2,6-dimethylphenyl)-8-(ethoxymethoxy)-1-(1-methoxyethoxy)-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] ethyl carbonate |
| SMILES | CCOCOC1CCC2(CC1)C(OC(=O)OCC)=C(c1c(C)cccc1C)C(=O)N2OC(C)OC |
| InChI | InChI=1S/C26H37NO8/c1-7-31-16-33-20-12-14-26(15-13-20)23(34-25(29)32-8-2)22(21-17(3)10-9-11-18(21)4)24(28)27(26)35-19(5)30-6/h9-11,19-20H,7-8,12-16H2,1-6H3 |
| InChIKey | IYQHEGZUDMHBOP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|