C18H18O5 — CID 139919860
2-methoxy-1,3-bis(3-methoxyphenyl)propane-1,3-dione (PubChem CID 139919860) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-methoxy-1,3-bis(3-methoxyphenyl)propane-1,3-dione.
| Compound Name | 2-methoxy-1,3-bis(3-methoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 139919860 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-methoxy-1,3-bis(3-methoxyphenyl)propane-1,3-dione |
| SMILES | COc1cccc(C(=O)C(OC)C(=O)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C18H18O5/c1-21-14-8-4-6-12(10-14)16(19)18(23-3)17(20)13-7-5-9-15(11-13)22-2/h4-11,18H,1-3H3 |
| InChIKey | PDVJZDWBUUECSF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|