About 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine
5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine (PubChem CID 139920001) has the molecular formula C10H14N4S2
and a molecular weight of 254.38 g/mol. Its IUPAC name is 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine |
| PubChem CID | 139920001 |
| Molecular Formula | C10H14N4S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine |
| SMILES | CCCCCSc1ncc2sc(N)nc2n1 |
| InChI | InChI=1S/C10H14N4S2/c1-2-3-4-5-15-10-12-6-7-8(14-10)13-9(11)16-7/h6H,2-5H2,1H3,(H2,11,12,13,14) |
| InChIKey | VTUVOWFNQMWLET-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine?
The IUPAC name of 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine (CID 139920001) is 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine.
What is the SMILES notation for 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine?
The canonical SMILES for 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine is CCCCCSc1ncc2sc(N)nc2n1.
What is the InChIKey of 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine?
The InChIKey is VTUVOWFNQMWLET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4S2/c1-2-3-4-5-15-10-12-6-7-8(14-10)13-9(11)16-7/h6H,2-5H2,1H3,(H2,11,12,13,14).
What are the key properties of 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine?
5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine has a molecular weight of 254.38 g/mol, XLogP of 2.95, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine is sourced from PubChem (CID 139920001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).