C31H34N2O5 — CID 139920431
3-[3-[3,4-dimethoxy-N-(2-phenylpropyl)anilino]anilino]-4-[(2-methylpropan-2-yl)oxy]cyclobut-3-ene-1,2-dione (PubChem CID 139920431) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is 3-[3-[3,4-dimethoxy-N-(2-phenylpropyl)anilino]anilino]-4-[(2-methylpropan-2-yl)oxy]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3-[3,4-dimethoxy-N-(2-phenylpropyl)anilino]anilino]-4-[(2-methylpropan-2-yl)oxy]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 139920431 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 3-[3-[3,4-dimethoxy-N-(2-phenylpropyl)anilino]anilino]-4-[(2-methylpropan-2-yl)oxy]cyclobut-3-ene-1,2-dione |
| SMILES | COc1ccc(N(CC(C)c2ccccc2)c2cccc(Nc3c(OC(C)(C)C)c(=O)c3=O)c2)cc1OC |
| InChI | InChI=1S/C31H34N2O5/c1-20(21-11-8-7-9-12-21)19-33(24-15-16-25(36-5)26(18-24)37-6)23-14-10-13-22(17-23)32-27-28(34)29(35)30(27)38-31(2,3)4/h7-18,20,32H,19H2,1-6H3 |
| InChIKey | DYYRFKYZIRYZLQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|