C21H34N10O4 — CID 139920677
6-[1-[3-[2-(4,6-diamino-1,3,5-triazin-2-yl)-2-methylpropyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]-2-methylpropan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 139920677) has the molecular formula C21H34N10O4 and a molecular weight of 490.57 g/mol. Its IUPAC name is 6-[1-[3-[2-(4,6-diamino-1,3,5-triazin-2-yl)-2-methylpropyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]-2-methylpropan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[3-[2-(4,6-diamino-1,3,5-triazin-2-yl)-2-methylpropyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]-2-methylpropan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139920677 |
| Molecular Formula | C21H34N10O4 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 6-[1-[3-[2-(4,6-diamino-1,3,5-triazin-2-yl)-2-methylpropyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]-2-methylpropan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(CC1OCC2(CO1)COC(CC(C)(C)c1nc(N)nc(N)n1)OC2)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C21H34N10O4/c1-19(2,13-26-15(22)30-16(23)27-13)5-11-32-7-21(8-33-11)9-34-12(35-10-21)6-20(3,4)14-28-17(24)31-18(25)29-14/h11-12H,5-10H2,1-4H3,(H4,22,23,26,27,30)(H4,24,25,28,29,31) |
| InChIKey | GEJANFOWFWLGBV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 218.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |