C22H21NO3 — CID 139921752
(E)-6-[3-(quinolin-2-ylmethoxy)phenyl]hex-2-enoic acid (PubChem CID 139921752) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is (E)-6-[3-(quinolin-2-ylmethoxy)phenyl]hex-2-enoic acid.
| Compound Name | (E)-6-[3-(quinolin-2-ylmethoxy)phenyl]hex-2-enoic acid |
|---|---|
| PubChem CID | 139921752 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (E)-6-[3-(quinolin-2-ylmethoxy)phenyl]hex-2-enoic acid |
| SMILES | O=C(O)/C=C/CCCc1cccc(OCc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C22H21NO3/c24-22(25)12-3-1-2-7-17-8-6-10-20(15-17)26-16-19-14-13-18-9-4-5-11-21(18)23-19/h3-6,8-15H,1-2,7,16H2,(H,24,25)/b12-3+ |
| InChIKey | FHQMCMZXHQSJON-KGVSQERTSA-N |
| XLogP | 4.78 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|