C20H21FO5 — CID 139921820
5-[3-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]pentanoic acid (PubChem CID 139921820) has the molecular formula C20H21FO5 and a molecular weight of 360.38 g/mol. Its IUPAC name is 5-[3-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]pentanoic acid.
| Compound Name | 5-[3-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 139921820 |
| Molecular Formula | C20H21FO5 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 5-[3-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]pentanoic acid |
| SMILES | O=C(O)CCCCc1cccc(OCc2cc(F)cc3c2OCOC3)c1 |
| InChI | InChI=1S/C20H21FO5/c21-17-9-15-11-24-13-26-20(15)16(10-17)12-25-18-6-3-5-14(8-18)4-1-2-7-19(22)23/h3,5-6,8-10H,1-2,4,7,11-13H2,(H,22,23) |
| InChIKey | PIYYOFRYCGRABV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|