C24H23NO3S — CID 139921972
2-[(2E)-2-[7-(quinolin-2-ylmethoxy)-3,4-dihydro-2H-naphthalen-1-ylidene]ethyl]sulfanylacetic acid (PubChem CID 139921972) has the molecular formula C24H23NO3S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-[(2E)-2-[7-(quinolin-2-ylmethoxy)-3,4-dihydro-2H-naphthalen-1-ylidene]ethyl]sulfanylacetic acid.
| Compound Name | 2-[(2E)-2-[7-(quinolin-2-ylmethoxy)-3,4-dihydro-2H-naphthalen-1-ylidene]ethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 139921972 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-[(2E)-2-[7-(quinolin-2-ylmethoxy)-3,4-dihydro-2H-naphthalen-1-ylidene]ethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSC/C=C1\CCCc2ccc(OCc3ccc4ccccc4n3)cc21 |
| InChI | InChI=1S/C24H23NO3S/c26-24(27)16-29-13-12-18-6-3-5-17-9-11-21(14-22(17)18)28-15-20-10-8-19-4-1-2-7-23(19)25-20/h1-2,4,7-12,14H,3,5-6,13,15-16H2,(H,26,27)/b18-12+ |
| InChIKey | XHGPSGOCXBYJLE-LDADJPATSA-N |
| XLogP | 5.35 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|