About 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene
3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene (PubChem CID 139922240) has the molecular formula C10H12Br2
and a molecular weight of 292.01 g/mol. Its IUPAC name is 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene.
Molecular Properties
| Compound Name | 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene |
| PubChem CID | 139922240 |
| Molecular Formula | C10H12Br2 |
| Molecular Weight | 292.01 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene |
| SMILES | Cc1cc(CBr)c(C)c(Br)c1C |
| InChI | InChI=1S/C10H12Br2/c1-6-4-9(5-11)8(3)10(12)7(6)2/h4H,5H2,1-3H3 |
| InChIKey | DJIMZFVKDFEFQA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.01 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene?
The IUPAC name of 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene (CID 139922240) is 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene.
What is the SMILES notation for 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene?
The canonical SMILES for 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene is Cc1cc(CBr)c(C)c(Br)c1C.
What is the InChIKey of 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene?
The InChIKey is DJIMZFVKDFEFQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Br2/c1-6-4-9(5-11)8(3)10(12)7(6)2/h4H,5H2,1-3H3.
What are the key properties of 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene?
3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene has a molecular weight of 292.01 g/mol, XLogP of 4.27, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-(bromomethyl)-2,4,5-trimethylbenzene is sourced from PubChem (CID 139922240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).