C22H21N3O2S — CID 139922641
4-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-2-[(4-hydroxyphenyl)methylidene]butanamide (PubChem CID 139922641) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 4-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-2-[(4-hydroxyphenyl)methylidene]butanamide.
| Compound Name | 4-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-2-[(4-hydroxyphenyl)methylidene]butanamide |
|---|---|
| PubChem CID | 139922641 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]-2-[(4-hydroxyphenyl)methylidene]butanamide |
| SMILES | NC(=O)C(=Cc1ccc(O)cc1)CCc1ccc(/N=C(\N)c2cccs2)cc1 |
| InChI | InChI=1S/C22H21N3O2S/c23-21(20-2-1-13-28-20)25-18-9-4-15(5-10-18)3-8-17(22(24)27)14-16-6-11-19(26)12-7-16/h1-2,4-7,9-14,26H,3,8H2,(H2,23,25)(H2,24,27) |
| InChIKey | BBLKVSPZSWZSGG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|