C27H26IN5O4 — CID 139922916
[(1S,2R,3R)-3-(2-amino-6-iodopurin-9-yl)-2-[(2-methylbenzoyl)oxymethyl]cyclobutyl]methyl 2-methylbenzoate (PubChem CID 139922916) has the molecular formula C27H26IN5O4 and a molecular weight of 611.44 g/mol. Its IUPAC name is [(1S,2R,3R)-3-(2-amino-6-iodopurin-9-yl)-2-[(2-methylbenzoyl)oxymethyl]cyclobutyl]methyl 2-methylbenzoate.
| Compound Name | [(1S,2R,3R)-3-(2-amino-6-iodopurin-9-yl)-2-[(2-methylbenzoyl)oxymethyl]cyclobutyl]methyl 2-methylbenzoate |
|---|---|
| PubChem CID | 139922916 |
| Molecular Formula | C27H26IN5O4 |
| Molecular Weight | 611.44 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | [(1S,2R,3R)-3-(2-amino-6-iodopurin-9-yl)-2-[(2-methylbenzoyl)oxymethyl]cyclobutyl]methyl 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OC[C@H]1C[C@@H](n2cnc3c(I)nc(N)nc32)[C@@H]1COC(=O)c1ccccc1C |
| InChI | InChI=1S/C27H26IN5O4/c1-15-7-3-5-9-18(15)25(34)36-12-17-11-21(33-14-30-22-23(28)31-27(29)32-24(22)33)20(17)13-37-26(35)19-10-6-4-8-16(19)2/h3-10,14,17,20-21H,11-13H2,1-2H3,(H2,29,31,32)/t17-,20-,21-/m1/s1 |
| InChIKey | PHBRIEKQXYIYOU-DUXKGJEZSA-N |
| XLogP | 4.52 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|