About (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one (PubChem CID 139923517) has the molecular formula C14H30O2Si
and a molecular weight of 258.48 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one.
Molecular Properties
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one |
| PubChem CID | 139923517 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one |
| SMILES | CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(C)=O |
| InChI | InChI=1S/C14H30O2Si/c1-10-12(14(6,7)11(2)15)16-17(8,9)13(3,4)5/h12H,10H2,1-9H3/t12-/m0/s1 |
| InChIKey | WHMSCFYLJOYUMG-LBPRGKRZSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one?
The IUPAC name of (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one (CID 139923517) is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one.
What is the SMILES notation for (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one?
The canonical SMILES for (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one is CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(C)=O.
What is the InChIKey of (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one?
The InChIKey is WHMSCFYLJOYUMG-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H30O2Si/c1-10-12(14(6,7)11(2)15)16-17(8,9)13(3,4)5/h12H,10H2,1-9H3/t12-/m0/s1.
What are the key properties of (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one?
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one has a molecular weight of 258.48 g/mol, XLogP of 4.40, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylhexan-2-one is sourced from PubChem (CID 139923517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).